About 1,3-dicyclohexyl-2-ethylguanidine;piperazine
1,3-dicyclohexyl-2-ethylguanidine;piperazine (PubChem CID 174890161) has the molecular formula C19H39N5
and a molecular weight of 337.56 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2-ethylguanidine;piperazine.
Molecular Properties
| Compound Name | 1,3-dicyclohexyl-2-ethylguanidine;piperazine |
| PubChem CID | 174890161 |
| Molecular Formula | C19H39N5 |
| Molecular Weight | 337.56 g/mol |
| Exact Mass | 337.32 |
| IUPAC Name | 1,3-dicyclohexyl-2-ethylguanidine;piperazine |
| SMILES | C1CNCCN1.CCN=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C15H29N3.C4H10N2/c1-2-16-15(17-13-9-5-3-6-10-13)18-14-11-7-4-8-12-14;1-2-6-4-3-5-1/h13-14H,2-12H2,1H3,(H2,16,17,18);5-6H,1-4H2 |
| InChIKey | DPUXHASENKANBB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dicyclohexyl-2-ethylguanidine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclohexyl-2-ethylguanidine;piperazine?
The IUPAC name of 1,3-dicyclohexyl-2-ethylguanidine;piperazine (CID 174890161) is 1,3-dicyclohexyl-2-ethylguanidine;piperazine.
What is the SMILES notation for 1,3-dicyclohexyl-2-ethylguanidine;piperazine?
The canonical SMILES for 1,3-dicyclohexyl-2-ethylguanidine;piperazine is C1CNCCN1.CCN=C(NC1CCCCC1)NC1CCCCC1.
What is the InChIKey of 1,3-dicyclohexyl-2-ethylguanidine;piperazine?
The InChIKey is DPUXHASENKANBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3.C4H10N2/c1-2-16-15(17-13-9-5-3-6-10-13)18-14-11-7-4-8-12-14;1-2-6-4-3-5-1/h13-14H,2-12H2,1H3,(H2,16,17,18);5-6H,1-4H2.
What are the key properties of 1,3-dicyclohexyl-2-ethylguanidine;piperazine?
1,3-dicyclohexyl-2-ethylguanidine;piperazine has a molecular weight of 337.56 g/mol, XLogP of 2.39, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclohexyl-2-ethylguanidine;piperazine is sourced from PubChem (CID 174890161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).