About 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide
6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide (PubChem CID 174890173) has the molecular formula C9H12Br2FNO
and a molecular weight of 329.01 g/mol. Its IUPAC name is 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide.
Molecular Properties
| Compound Name | 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide |
| PubChem CID | 174890173 |
| Molecular Formula | C9H12Br2FNO |
| Molecular Weight | 329.01 g/mol |
| Exact Mass | 326.93 |
| IUPAC Name | 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide |
| SMILES | FC1=CC(CBr)(CBr)CC=C1.NC=O |
| InChI | InChI=1S/C8H9Br2F.CH3NO/c9-5-8(6-10)3-1-2-7(11)4-8;2-1-3/h1-2,4H,3,5-6H2;1H,(H2,2,3) |
| InChIKey | VTSHLFQUMKCJIB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.01 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide?
The IUPAC name of 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide (CID 174890173) is 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide.
What is the SMILES notation for 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide?
The canonical SMILES for 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide is FC1=CC(CBr)(CBr)CC=C1.NC=O.
What is the InChIKey of 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide?
The InChIKey is VTSHLFQUMKCJIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Br2F.CH3NO/c9-5-8(6-10)3-1-2-7(11)4-8;2-1-3/h1-2,4H,3,5-6H2;1H,(H2,2,3).
What are the key properties of 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide?
6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide has a molecular weight of 329.01 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-bis(bromomethyl)-2-fluorocyclohexa-1,3-diene;formamide is sourced from PubChem (CID 174890173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).