C43H82N2O3 — CID 174890313
(9Z,28Z)-19-(dimethylamino)-19-[2-(2-hydroxyethylamino)ethyl]heptatriaconta-9,28-diene-18,20-dione (PubChem CID 174890313) has the molecular formula C43H82N2O3 and a molecular weight of 675.14 g/mol. Its IUPAC name is (9Z,28Z)-19-(dimethylamino)-19-[2-(2-hydroxyethylamino)ethyl]heptatriaconta-9,28-diene-18,20-dione.
| Compound Name | (9Z,28Z)-19-(dimethylamino)-19-[2-(2-hydroxyethylamino)ethyl]heptatriaconta-9,28-diene-18,20-dione |
|---|---|
| PubChem CID | 174890313 |
| Molecular Formula | C43H82N2O3 |
| Molecular Weight | 675.14 g/mol |
| Exact Mass | 674.63 |
| IUPAC Name | (9Z,28Z)-19-(dimethylamino)-19-[2-(2-hydroxyethylamino)ethyl]heptatriaconta-9,28-diene-18,20-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(CCNCCO)(C(=O)CCCCCCC/C=C\CCCCCCCC)N(C)C |
| InChI | InChI=1S/C43H82N2O3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41(47)43(45(3)4,37-38-44-39-40-46)42(48)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,44,46H,5-18,23-40H2,1-4H3/b21-19-,22-20- |
| InChIKey | VZLVXGQLGOBKMR-WRBBJXAJSA-N |
| XLogP | 11.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.14 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|