C37H45N5O4 — CID 174890346
[(3aR,6aS)-2-[2-[[4-[(4-carbamoylpiperidin-1-yl)methyl]benzoyl]-methylamino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate (PubChem CID 174890346) has the molecular formula C37H45N5O4 and a molecular weight of 623.80 g/mol. Its IUPAC name is [(3aR,6aS)-2-[2-[[4-[(4-carbamoylpiperidin-1-yl)methyl]benzoyl]-methylamino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [(3aR,6aS)-2-[2-[[4-[(4-carbamoylpiperidin-1-yl)methyl]benzoyl]-methylamino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 174890346 |
| Molecular Formula | C37H45N5O4 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.35 |
| IUPAC Name | [(3aR,6aS)-2-[2-[[4-[(4-carbamoylpiperidin-1-yl)methyl]benzoyl]-methylamino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CN(CCN1C[C@H]2CC(OC(=O)Nc3ccccc3-c3ccccc3)C[C@H]2C1)C(=O)c1ccc(CN2CCC(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C37H45N5O4/c1-40(36(44)29-13-11-26(12-14-29)23-41-17-15-28(16-18-41)35(38)43)19-20-42-24-30-21-32(22-31(30)25-42)46-37(45)39-34-10-6-5-9-33(34)27-7-3-2-4-8-27/h2-14,28,30-32H,15-25H2,1H3,(H2,38,43)(H,39,45)/t30-,31+,32? |
| InChIKey | RKIVPZMCVSJARH-BCFRNYDHSA-N |
| XLogP | 5.08 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |