About N,N-dimethylformamide;gold(1+);chloride
N,N-dimethylformamide;gold(1+);chloride (PubChem CID 174891064) has the molecular formula C3H7AuClNO
and a molecular weight of 305.52 g/mol. Its IUPAC name is N,N-dimethylformamide;gold(1+);chloride.
Molecular Properties
| Compound Name | N,N-dimethylformamide;gold(1+);chloride |
| PubChem CID | 174891064 |
| Molecular Formula | C3H7AuClNO |
| Molecular Weight | 305.52 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | N,N-dimethylformamide;gold(1+);chloride |
| SMILES | CN(C)C=O.[Au+].[Cl-] |
| InChI | InChI=1S/C3H7NO.Au.ClH/c1-4(2)3-5;;/h3H,1-2H3;;1H/q;+1;/p-1 |
| InChIKey | KXZLRUKMUIFVCS-UHFFFAOYSA-M |
| XLogP | -3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.52 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;gold(1+);chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;gold(1+);chloride?
The IUPAC name of N,N-dimethylformamide;gold(1+);chloride (CID 174891064) is N,N-dimethylformamide;gold(1+);chloride.
What is the SMILES notation for N,N-dimethylformamide;gold(1+);chloride?
The canonical SMILES for N,N-dimethylformamide;gold(1+);chloride is CN(C)C=O.[Au+].[Cl-].
What is the InChIKey of N,N-dimethylformamide;gold(1+);chloride?
The InChIKey is KXZLRUKMUIFVCS-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H7NO.Au.ClH/c1-4(2)3-5;;/h3H,1-2H3;;1H/q;+1;/p-1.
What are the key properties of N,N-dimethylformamide;gold(1+);chloride?
N,N-dimethylformamide;gold(1+);chloride has a molecular weight of 305.52 g/mol, XLogP of -3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;gold(1+);chloride is sourced from PubChem (CID 174891064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).