C19H31IN2 — CID 174891978
1,3-dibutyl-4,5-dimethyl-2-phenyl-2H-imidazole;hydroiodide (PubChem CID 174891978) has the molecular formula C19H31IN2 and a molecular weight of 414.38 g/mol. Its IUPAC name is 1,3-dibutyl-4,5-dimethyl-2-phenyl-2H-imidazole;hydroiodide.
| Compound Name | 1,3-dibutyl-4,5-dimethyl-2-phenyl-2H-imidazole;hydroiodide |
|---|---|
| PubChem CID | 174891978 |
| Molecular Formula | C19H31IN2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1,3-dibutyl-4,5-dimethyl-2-phenyl-2H-imidazole;hydroiodide |
| SMILES | CCCCN1C(C)=C(C)N(CCCC)C1c1ccccc1.I |
| InChI | InChI=1S/C19H30N2.HI/c1-5-7-14-20-16(3)17(4)21(15-8-6-2)19(20)18-12-10-9-11-13-18;/h9-13,19H,5-8,14-15H2,1-4H3;1H |
| InChIKey | IZEYRFYHGCBTHY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|