About 4-aminobenzoic acid;ethyl carbamate
4-aminobenzoic acid;ethyl carbamate (PubChem CID 174892580) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is 4-aminobenzoic acid;ethyl carbamate.
Molecular Properties
| Compound Name | 4-aminobenzoic acid;ethyl carbamate |
| PubChem CID | 174892580 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-aminobenzoic acid;ethyl carbamate |
| SMILES | CCOC(N)=O.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C7H7NO2.C3H7NO2/c8-6-3-1-5(2-4-6)7(9)10;1-2-6-3(4)5/h1-4H,8H2,(H,9,10);2H2,1H3,(H2,4,5) |
| InChIKey | YDBSKOPQQVZPHR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzoic acid;ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzoic acid;ethyl carbamate?
The IUPAC name of 4-aminobenzoic acid;ethyl carbamate (CID 174892580) is 4-aminobenzoic acid;ethyl carbamate.
What is the SMILES notation for 4-aminobenzoic acid;ethyl carbamate?
The canonical SMILES for 4-aminobenzoic acid;ethyl carbamate is CCOC(N)=O.Nc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-aminobenzoic acid;ethyl carbamate?
The InChIKey is YDBSKOPQQVZPHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C3H7NO2/c8-6-3-1-5(2-4-6)7(9)10;1-2-6-3(4)5/h1-4H,8H2,(H,9,10);2H2,1H3,(H2,4,5).
What are the key properties of 4-aminobenzoic acid;ethyl carbamate?
4-aminobenzoic acid;ethyl carbamate has a molecular weight of 226.23 g/mol, XLogP of 1.07, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzoic acid;ethyl carbamate is sourced from PubChem (CID 174892580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).