About 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole
3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole (PubChem CID 174894195) has the molecular formula C12H10F3N
and a molecular weight of 225.21 g/mol. Its IUPAC name is 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole.
Molecular Properties
| Compound Name | 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole |
| PubChem CID | 174894195 |
| Molecular Formula | C12H10F3N |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole |
| SMILES | FC(F)(F)Cn1ccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H10F3N/c13-12(14,15)9-16-7-6-11(8-16)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | UUFKGCKJZLBCIP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole?
The IUPAC name of 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole (CID 174894195) is 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole.
What is the SMILES notation for 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole?
The canonical SMILES for 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole is FC(F)(F)Cn1ccc(-c2ccccc2)c1.
What is the InChIKey of 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole?
The InChIKey is UUFKGCKJZLBCIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3N/c13-12(14,15)9-16-7-6-11(8-16)10-4-2-1-3-5-10/h1-8H,9H2.
What are the key properties of 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole?
3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole has a molecular weight of 225.21 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1-(2,2,2-trifluoroethyl)pyrrole is sourced from PubChem (CID 174894195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).