C9H13N3O6 — CID 174894609
1-(1-hydroxypropyl)-1,3,5-triazinane-2,4,6-trione;prop-2-enoic acid (PubChem CID 174894609) has the molecular formula C9H13N3O6 and a molecular weight of 259.22 g/mol. Its IUPAC name is 1-(1-hydroxypropyl)-1,3,5-triazinane-2,4,6-trione;prop-2-enoic acid.
| Compound Name | 1-(1-hydroxypropyl)-1,3,5-triazinane-2,4,6-trione;prop-2-enoic acid |
|---|---|
| PubChem CID | 174894609 |
| Molecular Formula | C9H13N3O6 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(1-hydroxypropyl)-1,3,5-triazinane-2,4,6-trione;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCC(O)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H9N3O4.C3H4O2/c1-2-3(10)9-5(12)7-4(11)8-6(9)13;1-2-3(4)5/h3,10H,2H2,1H3,(H2,7,8,11,12,13);2H,1H2,(H,4,5) |
| InChIKey | YJSVWXLHFHHIAV-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|