About disodium;furan-2,5-dione;hydride
disodium;furan-2,5-dione;hydride (PubChem CID 174894617) has the molecular formula C4H4Na2O3
and a molecular weight of 146.05 g/mol. Its IUPAC name is disodium;furan-2,5-dione;hydride.
Molecular Properties
| Compound Name | disodium;furan-2,5-dione;hydride |
| PubChem CID | 174894617 |
| Molecular Formula | C4H4Na2O3 |
| Molecular Weight | 146.05 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | disodium;furan-2,5-dione;hydride |
| SMILES | O=C1C=CC(=O)O1.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C4H2O3.2Na.2H/c5-3-1-2-4(6)7-3;;;;/h1-2H;;;;/q;2*+1;2*-1 |
| InChIKey | NWDDHUWFIMPKJI-UHFFFAOYSA-N |
| XLogP | -6.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.05 |
| LogP ≤ 5 | -6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze disodium;furan-2,5-dione;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;furan-2,5-dione;hydride?
The IUPAC name of disodium;furan-2,5-dione;hydride (CID 174894617) is disodium;furan-2,5-dione;hydride.
What is the SMILES notation for disodium;furan-2,5-dione;hydride?
The canonical SMILES for disodium;furan-2,5-dione;hydride is O=C1C=CC(=O)O1.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;furan-2,5-dione;hydride?
The InChIKey is NWDDHUWFIMPKJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3.2Na.2H/c5-3-1-2-4(6)7-3;;;;/h1-2H;;;;/q;2*+1;2*-1.
What are the key properties of disodium;furan-2,5-dione;hydride?
disodium;furan-2,5-dione;hydride has a molecular weight of 146.05 g/mol, XLogP of -6.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;furan-2,5-dione;hydride is sourced from PubChem (CID 174894617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).