C30H46O6S — CID 174894670
3,4-dimethoxythiophene;2-octoxycarbonyl-5-octylbenzoic acid (PubChem CID 174894670) has the molecular formula C30H46O6S and a molecular weight of 534.76 g/mol. Its IUPAC name is 3,4-dimethoxythiophene;2-octoxycarbonyl-5-octylbenzoic acid.
| Compound Name | 3,4-dimethoxythiophene;2-octoxycarbonyl-5-octylbenzoic acid |
|---|---|
| PubChem CID | 174894670 |
| Molecular Formula | C30H46O6S |
| Molecular Weight | 534.76 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 3,4-dimethoxythiophene;2-octoxycarbonyl-5-octylbenzoic acid |
| SMILES | CCCCCCCCOC(=O)c1ccc(CCCCCCCC)cc1C(=O)O.COc1cscc1OC |
| InChI | InChI=1S/C24H38O4.C6H8O2S/c1-3-5-7-9-11-13-15-20-16-17-21(22(19-20)23(25)26)24(27)28-18-14-12-10-8-6-4-2;1-7-5-3-9-4-6(5)8-2/h16-17,19H,3-15,18H2,1-2H3,(H,25,26);3-4H,1-2H3 |
| InChIKey | ZLOXDFJNSQJBOB-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.76 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|