About ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate
ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate (PubChem CID 174894690) has the molecular formula C20H32O7
and a molecular weight of 384.47 g/mol. Its IUPAC name is ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate |
| PubChem CID | 174894690 |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=C)C(=O)OCC.C=CC(=O)OCC(C)O |
| InChI | InChI=1S/C14H22O4.C6H10O3/c1-5-17-14(16)12(4)9-7-6-8-10-18-13(15)11(2)3;1-3-6(8)9-4-5(2)7/h2,4-10H2,1,3H3;3,5,7H,1,4H2,2H3 |
| InChIKey | CXZVCCHEPVYHFZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate?
The IUPAC name of ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate (CID 174894690) is ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate.
What is the SMILES notation for ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate?
The canonical SMILES for ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate is C=C(C)C(=O)OCCCCCC(=C)C(=O)OCC.C=CC(=O)OCC(C)O.
What is the InChIKey of ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate?
The InChIKey is CXZVCCHEPVYHFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4.C6H10O3/c1-5-17-14(16)12(4)9-7-6-8-10-18-13(15)11(2)3;1-3-6(8)9-4-5(2)7/h2,4-10H2,1,3H3;3,5,7H,1,4H2,2H3.
What are the key properties of ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate?
ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate has a molecular weight of 384.47 g/mol, XLogP of 2.88, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate;2-hydroxypropyl prop-2-enoate is sourced from PubChem (CID 174894690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).