About N,N-dimethylformamide;2,3-dimethylpyridin-4-amine
N,N-dimethylformamide;2,3-dimethylpyridin-4-amine (PubChem CID 174894950) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is N,N-dimethylformamide;2,3-dimethylpyridin-4-amine.
Molecular Properties
| Compound Name | N,N-dimethylformamide;2,3-dimethylpyridin-4-amine |
| PubChem CID | 174894950 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N,N-dimethylformamide;2,3-dimethylpyridin-4-amine |
| SMILES | CN(C)C=O.Cc1nccc(N)c1C |
| InChI | InChI=1S/C7H10N2.C3H7NO/c1-5-6(2)9-4-3-7(5)8;1-4(2)3-5/h3-4H,1-2H3,(H2,8,9);3H,1-2H3 |
| InChIKey | BSTAAFBBMFHLOK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;2,3-dimethylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;2,3-dimethylpyridin-4-amine?
The IUPAC name of N,N-dimethylformamide;2,3-dimethylpyridin-4-amine (CID 174894950) is N,N-dimethylformamide;2,3-dimethylpyridin-4-amine.
What is the SMILES notation for N,N-dimethylformamide;2,3-dimethylpyridin-4-amine?
The canonical SMILES for N,N-dimethylformamide;2,3-dimethylpyridin-4-amine is CN(C)C=O.Cc1nccc(N)c1C.
What is the InChIKey of N,N-dimethylformamide;2,3-dimethylpyridin-4-amine?
The InChIKey is BSTAAFBBMFHLOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C3H7NO/c1-5-6(2)9-4-3-7(5)8;1-4(2)3-5/h3-4H,1-2H3,(H2,8,9);3H,1-2H3.
What are the key properties of N,N-dimethylformamide;2,3-dimethylpyridin-4-amine?
N,N-dimethylformamide;2,3-dimethylpyridin-4-amine has a molecular weight of 195.27 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;2,3-dimethylpyridin-4-amine is sourced from PubChem (CID 174894950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).