C12H11F3N8 — CID 17489506
N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 17489506) has the molecular formula C12H11F3N8 and a molecular weight of 324.27 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 17489506 |
| Molecular Formula | C12H11F3N8 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | FC(F)(F)c1nnc2ccc(NCc3nnc4n3CCC4)nn12 |
| InChI | InChI=1S/C12H11F3N8/c13-12(14,15)11-20-18-9-4-3-7(21-23(9)11)16-6-10-19-17-8-2-1-5-22(8)10/h3-4H,1-2,5-6H2,(H,16,21) |
| InChIKey | BLCDCGHFHBQHSO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |