C26H28O — CID 174895423
1-butyl-1,2,3,4-tetrahydrochrysene;furan (PubChem CID 174895423) has the molecular formula C26H28O and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-butyl-1,2,3,4-tetrahydrochrysene;furan.
| Compound Name | 1-butyl-1,2,3,4-tetrahydrochrysene;furan |
|---|---|
| PubChem CID | 174895423 |
| Molecular Formula | C26H28O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-butyl-1,2,3,4-tetrahydrochrysene;furan |
| SMILES | CCCCC1CCCc2c1ccc1c2ccc2ccccc21.c1ccoc1 |
| InChI | InChI=1S/C22H24.C4H4O/c1-2-3-7-16-9-6-11-20-19(16)14-15-21-18-10-5-4-8-17(18)12-13-22(20)21;1-2-4-5-3-1/h4-5,8,10,12-16H,2-3,6-7,9,11H2,1H3;1-4H |
| InChIKey | FEILKNKFKWZIRU-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|