C24H28N4O3S — CID 17489584
(5-methyl-1-phenylpyrazol-4-yl)-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 17489584) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is (5-methyl-1-phenylpyrazol-4-yl)-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (5-methyl-1-phenylpyrazol-4-yl)-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17489584 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (5-methyl-1-phenylpyrazol-4-yl)-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(S(=O)(=O)c3ccc(C(C)C)cc3)CC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C24H28N4O3S/c1-18(2)20-9-11-22(12-10-20)32(30,31)27-15-13-26(14-16-27)24(29)23-17-25-28(19(23)3)21-7-5-4-6-8-21/h4-12,17-18H,13-16H2,1-3H3 |
| InChIKey | FIVZEHNWZJBDAT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |