About (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid
(2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid (PubChem CID 174896262) has the molecular formula C12H14N2O6S
and a molecular weight of 314.32 g/mol. Its IUPAC name is (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid.
Molecular Properties
| Compound Name | (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid |
| PubChem CID | 174896262 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid |
| SMILES | Nc1nc2ccc(CO)cc2s1.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C8H8N2OS.C4H6O5/c9-8-10-6-2-1-5(4-11)3-7(6)12-8;5-2(4(8)9)1-3(6)7/h1-3,11H,4H2,(H2,9,10);2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | NFBGGRCHJWVIMY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid?
The IUPAC name of (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid (CID 174896262) is (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid.
What is the SMILES notation for (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid?
The canonical SMILES for (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid is Nc1nc2ccc(CO)cc2s1.O=C(O)CC(O)C(=O)O.
What is the InChIKey of (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid?
The InChIKey is NFBGGRCHJWVIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS.C4H6O5/c9-8-10-6-2-1-5(4-11)3-7(6)12-8;5-2(4(8)9)1-3(6)7/h1-3,11H,4H2,(H2,9,10);2,5H,1H2,(H,6,7)(H,8,9).
What are the key properties of (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid?
(2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid has a molecular weight of 314.32 g/mol, XLogP of 0.28, 4 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,3-benzothiazol-6-yl)methanol;2-hydroxybutanedioic acid is sourced from PubChem (CID 174896262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).