About 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide
4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 174896778) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 174896778 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=CCC(N)(N)C=C1 |
| InChI | InChI=1S/C14H17N3O2/c1-19-12-5-3-2-4-11(12)17-13(18)10-6-8-14(15,16)9-7-10/h2-8H,9,15-16H2,1H3,(H,17,18) |
| InChIKey | REKFHCBSUWPKER-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide (CID 174896778) is 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide is COc1ccccc1NC(=O)C1=CCC(N)(N)C=C1.
What is the InChIKey of 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide?
The InChIKey is REKFHCBSUWPKER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-19-12-5-3-2-4-11(12)17-13(18)10-6-8-14(15,16)9-7-10/h2-8H,9,15-16H2,1H3,(H,17,18).
What are the key properties of 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide?
4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide has a molecular weight of 259.31 g/mol, XLogP of 1.13, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diamino-N-(2-methoxyphenyl)cyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 174896778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).