C13H10N2O10S — CID 174896802
1-(benzenesulfonyl)-3-nitro-3H-pyrrole-2,2,4-tricarboxylic acid (PubChem CID 174896802) has the molecular formula C13H10N2O10S and a molecular weight of 386.29 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-nitro-3H-pyrrole-2,2,4-tricarboxylic acid.
| Compound Name | 1-(benzenesulfonyl)-3-nitro-3H-pyrrole-2,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 174896802 |
| Molecular Formula | C13H10N2O10S |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 1-(benzenesulfonyl)-3-nitro-3H-pyrrole-2,2,4-tricarboxylic acid |
| SMILES | O=C(O)C1=CN(S(=O)(=O)c2ccccc2)C(C(=O)O)(C(=O)O)C1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10N2O10S/c16-10(17)8-6-14(26(24,25)7-4-2-1-3-5-7)13(11(18)19,12(20)21)9(8)15(22)23/h1-6,9H,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | RHMXAPVOONAKJQ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 192.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|