About cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane
cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane (PubChem CID 174896881) has the molecular formula C17H34O4Si
and a molecular weight of 330.54 g/mol. Its IUPAC name is cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane.
Molecular Properties
| Compound Name | cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane |
| PubChem CID | 174896881 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane |
| SMILES | C1CCCCC1.CC[Si](OC)(OC)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C11H22O4Si.C6H12/c1-4-16(12-2,13-3)14-8-9-5-6-10-11(7-9)15-10;1-2-4-6-5-3-1/h9-11H,4-8H2,1-3H3;1-6H2 |
| InChIKey | VBZQOUATSBDEAZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane?
The IUPAC name of cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane (CID 174896881) is cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane.
What is the SMILES notation for cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane?
The canonical SMILES for cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane is C1CCCCC1.CC[Si](OC)(OC)OCC1CCC2OC2C1.
What is the InChIKey of cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane?
The InChIKey is VBZQOUATSBDEAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4Si.C6H12/c1-4-16(12-2,13-3)14-8-9-5-6-10-11(7-9)15-10;1-2-4-6-5-3-1/h9-11H,4-8H2,1-3H3;1-6H2.
What are the key properties of cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane?
cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane has a molecular weight of 330.54 g/mol, XLogP of 4.16, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;ethyl-dimethoxy-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane is sourced from PubChem (CID 174896881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).