About 1H-indole;2H-quinoline-1-carboxylic acid
1H-indole;2H-quinoline-1-carboxylic acid (PubChem CID 174897265) has the molecular formula C18H16N2O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is 1H-indole;2H-quinoline-1-carboxylic acid.
Molecular Properties
| Compound Name | 1H-indole;2H-quinoline-1-carboxylic acid |
| PubChem CID | 174897265 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1H-indole;2H-quinoline-1-carboxylic acid |
| SMILES | O=C(O)N1CC=Cc2ccccc21.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C10H9NO2.C8H7N/c12-10(13)11-7-3-5-8-4-1-2-6-9(8)11;1-2-4-8-7(3-1)5-6-9-8/h1-6H,7H2,(H,12,13);1-6,9H |
| InChIKey | YYJKKQAGNBTYBC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indole;2H-quinoline-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;2H-quinoline-1-carboxylic acid?
The IUPAC name of 1H-indole;2H-quinoline-1-carboxylic acid (CID 174897265) is 1H-indole;2H-quinoline-1-carboxylic acid.
What is the SMILES notation for 1H-indole;2H-quinoline-1-carboxylic acid?
The canonical SMILES for 1H-indole;2H-quinoline-1-carboxylic acid is O=C(O)N1CC=Cc2ccccc21.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;2H-quinoline-1-carboxylic acid?
The InChIKey is YYJKKQAGNBTYBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2.C8H7N/c12-10(13)11-7-3-5-8-4-1-2-6-9(8)11;1-2-4-8-7(3-1)5-6-9-8/h1-6H,7H2,(H,12,13);1-6,9H.
What are the key properties of 1H-indole;2H-quinoline-1-carboxylic acid?
1H-indole;2H-quinoline-1-carboxylic acid has a molecular weight of 292.34 g/mol, XLogP of 4.37, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;2H-quinoline-1-carboxylic acid is sourced from PubChem (CID 174897265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).