C14H13NO8S — CID 174897285
1-(2-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylic acid (PubChem CID 174897285) has the molecular formula C14H13NO8S and a molecular weight of 355.32 g/mol. Its IUPAC name is 1-(2-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylic acid.
| Compound Name | 1-(2-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 174897285 |
| Molecular Formula | C14H13NO8S |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 1-(2-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylic acid |
| SMILES | Cc1ccccc1S(=O)(=O)N1C=C(C(=O)O)CC1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H13NO8S/c1-8-4-2-3-5-10(8)24(22,23)15-7-9(11(16)17)6-14(15,12(18)19)13(20)21/h2-5,7H,6H2,1H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | HDEJUFLGVFCWIP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|