About 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole
3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole (PubChem CID 174897334) has the molecular formula C18H11F4N3
and a molecular weight of 345.30 g/mol. Its IUPAC name is 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole |
| PubChem CID | 174897334 |
| Molecular Formula | C18H11F4N3 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole |
| SMILES | C1=NC2=CC=NC2=C1.Fc1c(-c2cccnc2)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H7F4N.C6H4N2/c13-11-9(8-3-2-6-17-7-8)4-1-5-10(11)12(14,15)16;1-3-7-6-2-4-8-5(1)6/h1-7H;1-4H |
| InChIKey | UTBQCVWIBHRXBN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole?
The IUPAC name of 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole (CID 174897334) is 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole.
What is the SMILES notation for 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole?
The canonical SMILES for 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole is C1=NC2=CC=NC2=C1.Fc1c(-c2cccnc2)cccc1C(F)(F)F.
What is the InChIKey of 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole?
The InChIKey is UTBQCVWIBHRXBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F4N.C6H4N2/c13-11-9(8-3-2-6-17-7-8)4-1-5-10(11)12(14,15)16;1-3-7-6-2-4-8-5(1)6/h1-7H;1-4H.
What are the key properties of 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole?
3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole has a molecular weight of 345.30 g/mol, XLogP of 4.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-fluoro-3-(trifluoromethyl)phenyl]pyridine;pyrrolo[3,2-b]pyrrole is sourced from PubChem (CID 174897334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).