About [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate
[1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate (PubChem CID 174897582) has the molecular formula C17H24N2O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate |
| PubChem CID | 174897582 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1CCN(C2CNc3ccccc32)C1 |
| InChI | InChI=1S/C17H24N2O2/c1-17(2,3)16(20)21-12-8-9-19(11-12)15-10-18-14-7-5-4-6-13(14)15/h4-7,12,15,18H,8-11H2,1-3H3 |
| InChIKey | VCUBRXRSFOPBIV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate?
The IUPAC name of [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate (CID 174897582) is [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC1CCN(C2CNc3ccccc32)C1.
What is the InChIKey of [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate?
The InChIKey is VCUBRXRSFOPBIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2/c1-17(2,3)16(20)21-12-8-9-19(11-12)15-10-18-14-7-5-4-6-13(14)15/h4-7,12,15,18H,8-11H2,1-3H3.
What are the key properties of [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate?
[1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate has a molecular weight of 288.39 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydro-1H-indol-3-yl)pyrrolidin-3-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 174897582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).