About 2,6-dimethoxy-1,5-dinitrosonaphthalene
2,6-dimethoxy-1,5-dinitrosonaphthalene (PubChem CID 174897734) has the molecular formula C12H10N2O4
and a molecular weight of 246.22 g/mol. Its IUPAC name is 2,6-dimethoxy-1,5-dinitrosonaphthalene.
Molecular Properties
| Compound Name | 2,6-dimethoxy-1,5-dinitrosonaphthalene |
| PubChem CID | 174897734 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2,6-dimethoxy-1,5-dinitrosonaphthalene |
| SMILES | COc1ccc2c(N=O)c(OC)ccc2c1N=O |
| InChI | InChI=1S/C12H10N2O4/c1-17-9-5-3-8-7(11(9)13-15)4-6-10(18-2)12(8)14-16/h3-6H,1-2H3 |
| InChIKey | WQWDICMCAHYGCO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,6-dimethoxy-1,5-dinitrosonaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethoxy-1,5-dinitrosonaphthalene?
The IUPAC name of 2,6-dimethoxy-1,5-dinitrosonaphthalene (CID 174897734) is 2,6-dimethoxy-1,5-dinitrosonaphthalene.
What is the SMILES notation for 2,6-dimethoxy-1,5-dinitrosonaphthalene?
The canonical SMILES for 2,6-dimethoxy-1,5-dinitrosonaphthalene is COc1ccc2c(N=O)c(OC)ccc2c1N=O.
What is the InChIKey of 2,6-dimethoxy-1,5-dinitrosonaphthalene?
The InChIKey is WQWDICMCAHYGCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O4/c1-17-9-5-3-8-7(11(9)13-15)4-6-10(18-2)12(8)14-16/h3-6H,1-2H3.
What are the key properties of 2,6-dimethoxy-1,5-dinitrosonaphthalene?
2,6-dimethoxy-1,5-dinitrosonaphthalene has a molecular weight of 246.22 g/mol, XLogP of 3.65, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethoxy-1,5-dinitrosonaphthalene is sourced from PubChem (CID 174897734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).