About 1,2-dihydropyridine-4-carbothioic S-acid
1,2-dihydropyridine-4-carbothioic S-acid (PubChem CID 174898031) has the molecular formula C6H7NOS
and a molecular weight of 141.19 g/mol. Its IUPAC name is 1,2-dihydropyridine-4-carbothioic S-acid.
Molecular Properties
| Compound Name | 1,2-dihydropyridine-4-carbothioic S-acid |
| PubChem CID | 174898031 |
| Molecular Formula | C6H7NOS |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.02 |
| IUPAC Name | 1,2-dihydropyridine-4-carbothioic S-acid |
| SMILES | O=C(S)C1=CCNC=C1 |
| InChI | InChI=1S/C6H7NOS/c8-6(9)5-1-3-7-4-2-5/h1-3,7H,4H2,(H,8,9) |
| InChIKey | SSILEVSXHQYFRK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydropyridine-4-carbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydropyridine-4-carbothioic S-acid?
The IUPAC name of 1,2-dihydropyridine-4-carbothioic S-acid (CID 174898031) is 1,2-dihydropyridine-4-carbothioic S-acid.
What is the SMILES notation for 1,2-dihydropyridine-4-carbothioic S-acid?
The canonical SMILES for 1,2-dihydropyridine-4-carbothioic S-acid is O=C(S)C1=CCNC=C1.
What is the InChIKey of 1,2-dihydropyridine-4-carbothioic S-acid?
The InChIKey is SSILEVSXHQYFRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NOS/c8-6(9)5-1-3-7-4-2-5/h1-3,7H,4H2,(H,8,9).
What are the key properties of 1,2-dihydropyridine-4-carbothioic S-acid?
1,2-dihydropyridine-4-carbothioic S-acid has a molecular weight of 141.19 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydropyridine-4-carbothioic S-acid is sourced from PubChem (CID 174898031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).