C10H14HgN2O5 — CID 174898498
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;mercury (PubChem CID 174898498) has the molecular formula C10H14HgN2O5 and a molecular weight of 442.82 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;mercury.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;mercury |
|---|---|
| PubChem CID | 174898498 |
| Molecular Formula | C10H14HgN2O5 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;mercury |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O.[Hg] |
| InChI | InChI=1S/C10H14N2O5.Hg/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8;/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16);/t6-,7+,8+;/m0./s1 |
| InChIKey | URRIJBCPVXJVEA-HNPMAXIBSA-N |
| XLogP | -1.52 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|