C8H14N4 — CID 174898965
1-(4,6-dimethyl-1,3,5-triazin-2-yl)propan-1-amine (PubChem CID 174898965) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 1-(4,6-dimethyl-1,3,5-triazin-2-yl)propan-1-amine.
| Compound Name | 1-(4,6-dimethyl-1,3,5-triazin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 174898965 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 1-(4,6-dimethyl-1,3,5-triazin-2-yl)propan-1-amine |
| SMILES | CCC(N)c1nc(C)nc(C)n1 |
| InChI | InChI=1S/C8H14N4/c1-4-7(9)8-11-5(2)10-6(3)12-8/h7H,4,9H2,1-3H3 |
| InChIKey | MSWOQVJFPTZFKO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |