About 1,1-dimethylurea;triphenylphosphane
1,1-dimethylurea;triphenylphosphane (PubChem CID 174899440) has the molecular formula C21H23N2OP
and a molecular weight of 350.40 g/mol. Its IUPAC name is 1,1-dimethylurea;triphenylphosphane.
Molecular Properties
| Compound Name | 1,1-dimethylurea;triphenylphosphane |
| PubChem CID | 174899440 |
| Molecular Formula | C21H23N2OP |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1,1-dimethylurea;triphenylphosphane |
| SMILES | CN(C)C(N)=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C3H8N2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5(2)3(4)6/h1-15H;1-2H3,(H2,4,6) |
| InChIKey | JVPQEBOZTGYUMT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethylurea;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylurea;triphenylphosphane?
The IUPAC name of 1,1-dimethylurea;triphenylphosphane (CID 174899440) is 1,1-dimethylurea;triphenylphosphane.
What is the SMILES notation for 1,1-dimethylurea;triphenylphosphane?
The canonical SMILES for 1,1-dimethylurea;triphenylphosphane is CN(C)C(N)=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1,1-dimethylurea;triphenylphosphane?
The InChIKey is JVPQEBOZTGYUMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C3H8N2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5(2)3(4)6/h1-15H;1-2H3,(H2,4,6).
What are the key properties of 1,1-dimethylurea;triphenylphosphane?
1,1-dimethylurea;triphenylphosphane has a molecular weight of 350.40 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylurea;triphenylphosphane is sourced from PubChem (CID 174899440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).