About 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene]
1H-indole;spiro[1,3-dihydroindole-2,2'-chromene] (PubChem CID 174899789) has the molecular formula C24H20N2O
and a molecular weight of 352.44 g/mol. Its IUPAC name is 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene].
Molecular Properties
| Compound Name | 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene] |
| PubChem CID | 174899789 |
| Molecular Formula | C24H20N2O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene] |
| SMILES | C1=CC2(Cc3ccccc3N2)Oc2ccccc21.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C16H13NO.C8H7N/c1-3-7-14-13(6-1)11-16(17-14)10-9-12-5-2-4-8-15(12)18-16;1-2-4-8-7(3-1)5-6-9-8/h1-10,17H,11H2;1-6,9H |
| InChIKey | KMRNDJAESYBSSX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene]?
The IUPAC name of 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene] (CID 174899789) is 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene].
What is the SMILES notation for 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene]?
The canonical SMILES for 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene] is C1=CC2(Cc3ccccc3N2)Oc2ccccc21.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene]?
The InChIKey is KMRNDJAESYBSSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO.C8H7N/c1-3-7-14-13(6-1)11-16(17-14)10-9-12-5-2-4-8-15(12)18-16;1-2-4-8-7(3-1)5-6-9-8/h1-10,17H,11H2;1-6,9H.
What are the key properties of 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene]?
1H-indole;spiro[1,3-dihydroindole-2,2'-chromene] has a molecular weight of 352.44 g/mol, XLogP of 5.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;spiro[1,3-dihydroindole-2,2'-chromene] is sourced from PubChem (CID 174899789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).