C11H18F6N5OP — CID 174899978
2H-benzotriazole;hydron;1,1,3,3-tetramethylurea;hexafluorophosphate (PubChem CID 174899978) has the molecular formula C11H18F6N5OP and a molecular weight of 381.26 g/mol. Its IUPAC name is 2H-benzotriazole;hydron;1,1,3,3-tetramethylurea;hexafluorophosphate.
| Compound Name | 2H-benzotriazole;hydron;1,1,3,3-tetramethylurea;hexafluorophosphate |
|---|---|
| PubChem CID | 174899978 |
| Molecular Formula | C11H18F6N5OP |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2H-benzotriazole;hydron;1,1,3,3-tetramethylurea;hexafluorophosphate |
| SMILES | CN(C)C(=O)N(C)C.F[P-](F)(F)(F)(F)F.[H+].c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.C5H12N2O.F6P/c1-2-4-6-5(3-1)7-9-8-6;1-6(2)5(8)7(3)4;1-7(2,3,4,5)6/h1-4H,(H,7,8,9);1-4H3;/q;;-1/p+1 |
| InChIKey | GOYXYNDAQKKYGZ-UHFFFAOYSA-O |
| XLogP | 4.68 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|