About 7-bromo-2-(trifluoromethyl)quinoline;quinoline
7-bromo-2-(trifluoromethyl)quinoline;quinoline (PubChem CID 174900044) has the molecular formula C19H12BrF3N2
and a molecular weight of 405.22 g/mol. Its IUPAC name is 7-bromo-2-(trifluoromethyl)quinoline;quinoline.
Molecular Properties
| Compound Name | 7-bromo-2-(trifluoromethyl)quinoline;quinoline |
| PubChem CID | 174900044 |
| Molecular Formula | C19H12BrF3N2 |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 7-bromo-2-(trifluoromethyl)quinoline;quinoline |
| SMILES | FC(F)(F)c1ccc2ccc(Br)cc2n1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C10H5BrF3N.C9H7N/c11-7-3-1-6-2-4-9(10(12,13)14)15-8(6)5-7;1-2-6-9-8(4-1)5-3-7-10-9/h1-5H;1-7H |
| InChIKey | BXISESGOIRMRKH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2-(trifluoromethyl)quinoline;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-(trifluoromethyl)quinoline;quinoline?
The IUPAC name of 7-bromo-2-(trifluoromethyl)quinoline;quinoline (CID 174900044) is 7-bromo-2-(trifluoromethyl)quinoline;quinoline.
What is the SMILES notation for 7-bromo-2-(trifluoromethyl)quinoline;quinoline?
The canonical SMILES for 7-bromo-2-(trifluoromethyl)quinoline;quinoline is FC(F)(F)c1ccc2ccc(Br)cc2n1.c1ccc2ncccc2c1.
What is the InChIKey of 7-bromo-2-(trifluoromethyl)quinoline;quinoline?
The InChIKey is BXISESGOIRMRKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrF3N.C9H7N/c11-7-3-1-6-2-4-9(10(12,13)14)15-8(6)5-7;1-2-6-9-8(4-1)5-3-7-10-9/h1-5H;1-7H.
What are the key properties of 7-bromo-2-(trifluoromethyl)quinoline;quinoline?
7-bromo-2-(trifluoromethyl)quinoline;quinoline has a molecular weight of 405.22 g/mol, XLogP of 6.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-(trifluoromethyl)quinoline;quinoline is sourced from PubChem (CID 174900044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).