About 2,2-dimethylpropanoyl chloride;tetrachloromethane
2,2-dimethylpropanoyl chloride;tetrachloromethane (PubChem CID 174900107) has the molecular formula C6H9Cl5O
and a molecular weight of 274.40 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl chloride;tetrachloromethane.
Molecular Properties
| Compound Name | 2,2-dimethylpropanoyl chloride;tetrachloromethane |
| PubChem CID | 174900107 |
| Molecular Formula | C6H9Cl5O |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 271.91 |
| IUPAC Name | 2,2-dimethylpropanoyl chloride;tetrachloromethane |
| SMILES | CC(C)(C)C(=O)Cl.ClC(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H9ClO.CCl4/c1-5(2,3)4(6)7;2-1(3,4)5/h1-3H3; |
| InChIKey | ISLUUTUQMSTOHN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropanoyl chloride;tetrachloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropanoyl chloride;tetrachloromethane?
The IUPAC name of 2,2-dimethylpropanoyl chloride;tetrachloromethane (CID 174900107) is 2,2-dimethylpropanoyl chloride;tetrachloromethane.
What is the SMILES notation for 2,2-dimethylpropanoyl chloride;tetrachloromethane?
The canonical SMILES for 2,2-dimethylpropanoyl chloride;tetrachloromethane is CC(C)(C)C(=O)Cl.ClC(Cl)(Cl)Cl.
What is the InChIKey of 2,2-dimethylpropanoyl chloride;tetrachloromethane?
The InChIKey is ISLUUTUQMSTOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO.CCl4/c1-5(2,3)4(6)7;2-1(3,4)5/h1-3H3;.
What are the key properties of 2,2-dimethylpropanoyl chloride;tetrachloromethane?
2,2-dimethylpropanoyl chloride;tetrachloromethane has a molecular weight of 274.40 g/mol, XLogP of 4.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanoyl chloride;tetrachloromethane is sourced from PubChem (CID 174900107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).