About bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol
bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol (PubChem CID 174900459) has the molecular formula C13H26O4Si
and a molecular weight of 274.43 g/mol. Its IUPAC name is bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol.
Molecular Properties
| Compound Name | bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol |
| PubChem CID | 174900459 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol |
| SMILES | C=COC=C.C=C[Si](C)(C)C=C.OCC(O)CO |
| InChI | InChI=1S/C6H12Si.C4H6O.C3H8O3/c1-5-7(3,4)6-2;1-3-5-4-2;4-1-3(6)2-5/h5-6H,1-2H2,3-4H3;3-4H,1-2H2;3-6H,1-2H2 |
| InChIKey | JRLCFGCBFMZNKZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol?
The IUPAC name of bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol (CID 174900459) is bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol.
What is the SMILES notation for bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol?
The canonical SMILES for bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol is C=COC=C.C=C[Si](C)(C)C=C.OCC(O)CO.
What is the InChIKey of bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol?
The InChIKey is JRLCFGCBFMZNKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Si.C4H6O.C3H8O3/c1-5-7(3,4)6-2;1-3-5-4-2;4-1-3(6)2-5/h5-6H,1-2H2,3-4H3;3-4H,1-2H2;3-6H,1-2H2.
What are the key properties of bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol?
bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol has a molecular weight of 274.43 g/mol, XLogP of 1.77, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethenyl)-dimethylsilane;ethenoxyethene;propane-1,2,3-triol is sourced from PubChem (CID 174900459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).