C20H23NO5 — CID 174900682
1-ethoxypyrrolidin-2-one;2,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 174900682) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-ethoxypyrrolidin-2-one;2,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 1-ethoxypyrrolidin-2-one;2,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 174900682 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-ethoxypyrrolidin-2-one;2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | CCON1CCCC1=O.Cc1cc2cc3c(C)cc(=O)oc3c(C)c2o1 |
| InChI | InChI=1S/C14H12O3.C6H11NO2/c1-7-4-12(15)17-14-9(3)13-10(6-11(7)14)5-8(2)16-13;1-2-9-7-5-3-4-6(7)8/h4-6H,1-3H3;2-5H2,1H3 |
| InChIKey | PDVMLQYOEZQUJI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|