C10H15NO — CID 174901090
4-methylidene-2,3,6,7,8,9-hexahydroquinolizin-2-ol (PubChem CID 174901090) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-methylidene-2,3,6,7,8,9-hexahydroquinolizin-2-ol.
| Compound Name | 4-methylidene-2,3,6,7,8,9-hexahydroquinolizin-2-ol |
|---|---|
| PubChem CID | 174901090 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-methylidene-2,3,6,7,8,9-hexahydroquinolizin-2-ol |
| SMILES | C=C1CC(O)C=C2CCCCN12 |
| InChI | InChI=1S/C10H15NO/c1-8-6-10(12)7-9-4-2-3-5-11(8)9/h7,10,12H,1-6H2 |
| InChIKey | UMTBMULVLXSQEQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |