About 1-ethyl-1-oxido-2,3-dihydroindol-1-ium
1-ethyl-1-oxido-2,3-dihydroindol-1-ium (PubChem CID 174901111) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-ethyl-1-oxido-2,3-dihydroindol-1-ium.
Molecular Properties
| Compound Name | 1-ethyl-1-oxido-2,3-dihydroindol-1-ium |
| PubChem CID | 174901111 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-ethyl-1-oxido-2,3-dihydroindol-1-ium |
| SMILES | CC[N+]1([O-])CCc2ccccc21 |
| InChI | InChI=1S/C10H13NO/c1-2-11(12)8-7-9-5-3-4-6-10(9)11/h3-6H,2,7-8H2,1H3 |
| InChIKey | OUUTXVOLNUCYLJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-oxido-2,3-dihydroindol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-oxido-2,3-dihydroindol-1-ium?
The IUPAC name of 1-ethyl-1-oxido-2,3-dihydroindol-1-ium (CID 174901111) is 1-ethyl-1-oxido-2,3-dihydroindol-1-ium.
What is the SMILES notation for 1-ethyl-1-oxido-2,3-dihydroindol-1-ium?
The canonical SMILES for 1-ethyl-1-oxido-2,3-dihydroindol-1-ium is CC[N+]1([O-])CCc2ccccc21.
What is the InChIKey of 1-ethyl-1-oxido-2,3-dihydroindol-1-ium?
The InChIKey is OUUTXVOLNUCYLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-2-11(12)8-7-9-5-3-4-6-10(9)11/h3-6H,2,7-8H2,1H3.
What are the key properties of 1-ethyl-1-oxido-2,3-dihydroindol-1-ium?
1-ethyl-1-oxido-2,3-dihydroindol-1-ium has a molecular weight of 163.22 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-oxido-2,3-dihydroindol-1-ium is sourced from PubChem (CID 174901111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).