About 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine
3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine (PubChem CID 174901331) has the molecular formula C14H34N6
and a molecular weight of 286.47 g/mol. Its IUPAC name is 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine.
Molecular Properties
| Compound Name | 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine |
| PubChem CID | 174901331 |
| Molecular Formula | C14H34N6 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.28 |
| IUPAC Name | 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine |
| SMILES | C1CNCCN1.NCCCC1CNCCN1CCCN |
| InChI | InChI=1S/C10H24N4.C4H10N2/c11-4-1-3-10-9-13-6-8-14(10)7-2-5-12;1-2-6-4-3-5-1/h10,13H,1-9,11-12H2;5-6H,1-4H2 |
| InChIKey | VZEQMWQBPWERLO-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 91.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine?
The IUPAC name of 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine (CID 174901331) is 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine.
What is the SMILES notation for 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine?
The canonical SMILES for 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine is C1CNCCN1.NCCCC1CNCCN1CCCN.
What is the InChIKey of 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine?
The InChIKey is VZEQMWQBPWERLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N4.C4H10N2/c11-4-1-3-10-9-13-6-8-14(10)7-2-5-12;1-2-6-4-3-5-1/h10,13H,1-9,11-12H2;5-6H,1-4H2.
What are the key properties of 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine?
3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine has a molecular weight of 286.47 g/mol, XLogP of -1.47, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;piperazine is sourced from PubChem (CID 174901331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).