C19H26N2O7 — CID 174902683
[[(3S,4R)-1-butyl-4-(3,4-dimethoxyphenyl)-6-oxopiperidine-3-carbonyl]amino] hydrogen carbonate (PubChem CID 174902683) has the molecular formula C19H26N2O7 and a molecular weight of 394.42 g/mol. Its IUPAC name is [[(3S,4R)-1-butyl-4-(3,4-dimethoxyphenyl)-6-oxopiperidine-3-carbonyl]amino] hydrogen carbonate.
| Compound Name | [[(3S,4R)-1-butyl-4-(3,4-dimethoxyphenyl)-6-oxopiperidine-3-carbonyl]amino] hydrogen carbonate |
|---|---|
| PubChem CID | 174902683 |
| Molecular Formula | C19H26N2O7 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [[(3S,4R)-1-butyl-4-(3,4-dimethoxyphenyl)-6-oxopiperidine-3-carbonyl]amino] hydrogen carbonate |
| SMILES | CCCCN1C[C@@H](C(=O)NOC(=O)O)[C@H](c2ccc(OC)c(OC)c2)CC1=O |
| InChI | InChI=1S/C19H26N2O7/c1-4-5-8-21-11-14(18(23)20-28-19(24)25)13(10-17(21)22)12-6-7-15(26-2)16(9-12)27-3/h6-7,9,13-14H,4-5,8,10-11H2,1-3H3,(H,20,23)(H,24,25)/t13-,14+/m0/s1 |
| InChIKey | YTKAEXVCAJLVJR-UONOGXRCSA-N |
| XLogP | 2.16 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|