C4Br2Cl2F6 — CID 174903019
1,2-dibromo-1,1-dichloro-2,3,3,4,4,4-hexafluorobutane (PubChem CID 174903019) has the molecular formula C4Br2Cl2F6 and a molecular weight of 392.75 g/mol. Its IUPAC name is 1,2-dibromo-1,1-dichloro-2,3,3,4,4,4-hexafluorobutane.
| Compound Name | 1,2-dibromo-1,1-dichloro-2,3,3,4,4,4-hexafluorobutane |
|---|---|
| PubChem CID | 174903019 |
| Molecular Formula | C4Br2Cl2F6 |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 389.76 |
| IUPAC Name | 1,2-dibromo-1,1-dichloro-2,3,3,4,4,4-hexafluorobutane |
| SMILES | FC(F)(F)C(F)(F)C(F)(Br)C(Cl)(Cl)Br |
| InChI | InChI=1S/C4Br2Cl2F6/c5-1(9,3(6,7)8)2(10,11)4(12,13)14 |
| InChIKey | BOOJSBJRZVTXEU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|