About 1,2-diethyl-4,5-dihydroimidazole;hydrobromide
1,2-diethyl-4,5-dihydroimidazole;hydrobromide (PubChem CID 174903363) has the molecular formula C7H15BrN2
and a molecular weight of 207.11 g/mol. Its IUPAC name is 1,2-diethyl-4,5-dihydroimidazole;hydrobromide.
Molecular Properties
| Compound Name | 1,2-diethyl-4,5-dihydroimidazole;hydrobromide |
| PubChem CID | 174903363 |
| Molecular Formula | C7H15BrN2 |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 1,2-diethyl-4,5-dihydroimidazole;hydrobromide |
| SMILES | Br.CCC1=NCCN1CC |
| InChI | InChI=1S/C7H14N2.BrH/c1-3-7-8-5-6-9(7)4-2;/h3-6H2,1-2H3;1H |
| InChIKey | VHXYMHYXBLJZPW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-diethyl-4,5-dihydroimidazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-4,5-dihydroimidazole;hydrobromide?
The IUPAC name of 1,2-diethyl-4,5-dihydroimidazole;hydrobromide (CID 174903363) is 1,2-diethyl-4,5-dihydroimidazole;hydrobromide.
What is the SMILES notation for 1,2-diethyl-4,5-dihydroimidazole;hydrobromide?
The canonical SMILES for 1,2-diethyl-4,5-dihydroimidazole;hydrobromide is Br.CCC1=NCCN1CC.
What is the InChIKey of 1,2-diethyl-4,5-dihydroimidazole;hydrobromide?
The InChIKey is VHXYMHYXBLJZPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.BrH/c1-3-7-8-5-6-9(7)4-2;/h3-6H2,1-2H3;1H.
What are the key properties of 1,2-diethyl-4,5-dihydroimidazole;hydrobromide?
1,2-diethyl-4,5-dihydroimidazole;hydrobromide has a molecular weight of 207.11 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-4,5-dihydroimidazole;hydrobromide is sourced from PubChem (CID 174903363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).