C22H19F2N3O — CID 174904215
N-[(3,4-difluorophenyl)methyl]-7-phenylmethoxy-6H-1,7-naphthyridin-2-amine (PubChem CID 174904215) has the molecular formula C22H19F2N3O and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-7-phenylmethoxy-6H-1,7-naphthyridin-2-amine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-7-phenylmethoxy-6H-1,7-naphthyridin-2-amine |
|---|---|
| PubChem CID | 174904215 |
| Molecular Formula | C22H19F2N3O |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-7-phenylmethoxy-6H-1,7-naphthyridin-2-amine |
| SMILES | Fc1ccc(CNc2ccc3c(n2)=CN(OCc2ccccc2)CC=3)cc1F |
| InChI | InChI=1S/C22H19F2N3O/c23-19-8-6-17(12-20(19)24)13-25-22-9-7-18-10-11-27(14-21(18)26-22)28-15-16-4-2-1-3-5-16/h1-10,12,14H,11,13,15H2,(H,25,26) |
| InChIKey | YFYQTJVXASPPMX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |