About 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane
1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane (PubChem CID 174904279) has the molecular formula C23H48O
and a molecular weight of 340.64 g/mol. Its IUPAC name is 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane.
Molecular Properties
| Compound Name | 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane |
| PubChem CID | 174904279 |
| Molecular Formula | C23H48O |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.37 |
| IUPAC Name | 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane |
| SMILES | CC1(O)CCCCCC1.CCC(C)CCC(C)CCCCC(C)C |
| InChI | InChI=1S/C15H32.C8H16O/c1-6-14(4)11-12-15(5)10-8-7-9-13(2)3;1-8(9)6-4-2-3-5-7-8/h13-15H,6-12H2,1-5H3;9H,2-7H2,1H3 |
| InChIKey | VPRNGVLACWFUGY-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane?
The IUPAC name of 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane (CID 174904279) is 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane.
What is the SMILES notation for 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane?
The canonical SMILES for 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane is CC1(O)CCCCCC1.CCC(C)CCC(C)CCCCC(C)C.
What is the InChIKey of 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane?
The InChIKey is VPRNGVLACWFUGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32.C8H16O/c1-6-14(4)11-12-15(5)10-8-7-9-13(2)3;1-8(9)6-4-2-3-5-7-8/h13-15H,6-12H2,1-5H3;9H,2-7H2,1H3.
What are the key properties of 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane?
1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane has a molecular weight of 340.64 g/mol, XLogP of 7.76, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcycloheptan-1-ol;2,7,10-trimethyldodecane is sourced from PubChem (CID 174904279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).