C26H26 — CID 174904780
benzene;(2R)-2-ethyl-2,3,4,5-tetrahydrochrysene (PubChem CID 174904780) has the molecular formula C26H26 and a molecular weight of 338.49 g/mol. Its IUPAC name is benzene;(2R)-2-ethyl-2,3,4,5-tetrahydrochrysene.
| Compound Name | benzene;(2R)-2-ethyl-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174904780 |
| Molecular Formula | C26H26 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | benzene;(2R)-2-ethyl-2,3,4,5-tetrahydrochrysene |
| SMILES | CC[C@H]1C=c2ccc3c(c2CC1)CC=c1ccccc1=3.c1ccccc1 |
| InChI | InChI=1S/C20H20.C6H6/c1-2-14-7-10-18-16(13-14)9-12-19-17-6-4-3-5-15(17)8-11-20(18)19;1-2-4-6-5-3-1/h3-6,8-9,12-14H,2,7,10-11H2,1H3;1-6H/t14-;/m1./s1 |
| InChIKey | VKUGICNNCLPYII-PFEQFJNWSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |