About bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene
bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene (PubChem CID 174904901) has the molecular formula C11H15Cl
and a molecular weight of 182.69 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene |
| PubChem CID | 174904901 |
| Molecular Formula | C11H15Cl |
| Molecular Weight | 182.69 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene |
| SMILES | C1=CC2CCC1C2.C=CC=CCl |
| InChI | InChI=1S/C7H10.C4H5Cl/c1-2-7-4-3-6(1)5-7;1-2-3-4-5/h1-2,6-7H,3-5H2;2-4H,1H2 |
| InChIKey | ZCWOAUIOOZWKLI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.69 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene (CID 174904901) is bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene is C1=CC2CCC1C2.C=CC=CCl.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene?
The InChIKey is ZCWOAUIOOZWKLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.C4H5Cl/c1-2-7-4-3-6(1)5-7;1-2-3-4-5/h1-2,6-7H,3-5H2;2-4H,1H2.
What are the key properties of bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene?
bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene has a molecular weight of 182.69 g/mol, XLogP of 3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;1-chlorobuta-1,3-diene is sourced from PubChem (CID 174904901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).