About (tert-butyl-chloro-methylsilyl)methanol;silane
(tert-butyl-chloro-methylsilyl)methanol;silane (PubChem CID 174904942) has the molecular formula C6H19ClOSi2
and a molecular weight of 198.84 g/mol. Its IUPAC name is (tert-butyl-chloro-methylsilyl)methanol;silane.
Molecular Properties
| Compound Name | (tert-butyl-chloro-methylsilyl)methanol;silane |
| PubChem CID | 174904942 |
| Molecular Formula | C6H19ClOSi2 |
| Molecular Weight | 198.84 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (tert-butyl-chloro-methylsilyl)methanol;silane |
| SMILES | CC(C)(C)[Si](C)(Cl)CO.[SiH4] |
| InChI | InChI=1S/C6H15ClOSi.H4Si/c1-6(2,3)9(4,7)5-8;/h8H,5H2,1-4H3;1H4 |
| InChIKey | AJBQTWMAZLOCNO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.84 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze (tert-butyl-chloro-methylsilyl)methanol;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (tert-butyl-chloro-methylsilyl)methanol;silane?
The IUPAC name of (tert-butyl-chloro-methylsilyl)methanol;silane (CID 174904942) is (tert-butyl-chloro-methylsilyl)methanol;silane.
What is the SMILES notation for (tert-butyl-chloro-methylsilyl)methanol;silane?
The canonical SMILES for (tert-butyl-chloro-methylsilyl)methanol;silane is CC(C)(C)[Si](C)(Cl)CO.[SiH4].
What is the InChIKey of (tert-butyl-chloro-methylsilyl)methanol;silane?
The InChIKey is AJBQTWMAZLOCNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15ClOSi.H4Si/c1-6(2,3)9(4,7)5-8;/h8H,5H2,1-4H3;1H4.
What are the key properties of (tert-butyl-chloro-methylsilyl)methanol;silane?
(tert-butyl-chloro-methylsilyl)methanol;silane has a molecular weight of 198.84 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (tert-butyl-chloro-methylsilyl)methanol;silane is sourced from PubChem (CID 174904942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).