About 1-(4-ethynylphenyl)-2,4-dimethylpyrrole
1-(4-ethynylphenyl)-2,4-dimethylpyrrole (PubChem CID 174905157) has the molecular formula C14H13N
and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-(4-ethynylphenyl)-2,4-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-(4-ethynylphenyl)-2,4-dimethylpyrrole |
| PubChem CID | 174905157 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-(4-ethynylphenyl)-2,4-dimethylpyrrole |
| SMILES | C#Cc1ccc(-n2cc(C)cc2C)cc1 |
| InChI | InChI=1S/C14H13N/c1-4-13-5-7-14(8-6-13)15-10-11(2)9-12(15)3/h1,5-10H,2-3H3 |
| InChIKey | VBFNTZPBBQPYAQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethynylphenyl)-2,4-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethynylphenyl)-2,4-dimethylpyrrole?
The IUPAC name of 1-(4-ethynylphenyl)-2,4-dimethylpyrrole (CID 174905157) is 1-(4-ethynylphenyl)-2,4-dimethylpyrrole.
What is the SMILES notation for 1-(4-ethynylphenyl)-2,4-dimethylpyrrole?
The canonical SMILES for 1-(4-ethynylphenyl)-2,4-dimethylpyrrole is C#Cc1ccc(-n2cc(C)cc2C)cc1.
What is the InChIKey of 1-(4-ethynylphenyl)-2,4-dimethylpyrrole?
The InChIKey is VBFNTZPBBQPYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N/c1-4-13-5-7-14(8-6-13)15-10-11(2)9-12(15)3/h1,5-10H,2-3H3.
What are the key properties of 1-(4-ethynylphenyl)-2,4-dimethylpyrrole?
1-(4-ethynylphenyl)-2,4-dimethylpyrrole has a molecular weight of 195.26 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethynylphenyl)-2,4-dimethylpyrrole is sourced from PubChem (CID 174905157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).