About (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine
(5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine (PubChem CID 174905553) has the molecular formula C21H27NS
and a molecular weight of 325.52 g/mol. Its IUPAC name is (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine.
Molecular Properties
| Compound Name | (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine |
| PubChem CID | 174905553 |
| Molecular Formula | C21H27NS |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine |
| SMILES | CCc1ccc(CCCc2ccc(C[C@@H]3CNCS3)cc2)cc1 |
| InChI | InChI=1S/C21H27NS/c1-2-17-6-8-18(9-7-17)4-3-5-19-10-12-20(13-11-19)14-21-15-22-16-23-21/h6-13,21-22H,2-5,14-16H2,1H3/t21-/m1/s1 |
| InChIKey | HUCSVGATAVRGDL-OAQYLSRUSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine?
The IUPAC name of (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine (CID 174905553) is (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine.
What is the SMILES notation for (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine?
The canonical SMILES for (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine is CCc1ccc(CCCc2ccc(C[C@@H]3CNCS3)cc2)cc1.
What is the InChIKey of (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine?
The InChIKey is HUCSVGATAVRGDL-OAQYLSRUSA-N. The full InChI is InChI=1S/C21H27NS/c1-2-17-6-8-18(9-7-17)4-3-5-19-10-12-20(13-11-19)14-21-15-22-16-23-21/h6-13,21-22H,2-5,14-16H2,1H3/t21-/m1/s1.
What are the key properties of (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine?
(5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine has a molecular weight of 325.52 g/mol, XLogP of 4.63, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[[4-[3-(4-ethylphenyl)propyl]phenyl]methyl]-1,3-thiazolidine is sourced from PubChem (CID 174905553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).