About [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite
[methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite (PubChem CID 174905768) has the molecular formula C22H17F3N4O4S
and a molecular weight of 490.46 g/mol. Its IUPAC name is [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite.
Molecular Properties
| Compound Name | [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite |
| PubChem CID | 174905768 |
| Molecular Formula | C22H17F3N4O4S |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite |
| SMILES | CN(OS(=O)O)c1ccc2cc(C(=O)Nc3cccc(-c4cnccc4C(F)(F)F)c3)[nH]c2c1 |
| InChI | InChI=1S/C22H17F3N4O4S/c1-29(33-34(31)32)16-6-5-14-10-20(28-19(14)11-16)21(30)27-15-4-2-3-13(9-15)17-12-26-8-7-18(17)22(23,24)25/h2-12,28H,1H3,(H,27,30)(H,31,32) |
| InChIKey | RIPICGZRFKGILH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite?
The IUPAC name of [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite (CID 174905768) is [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite.
What is the SMILES notation for [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite?
The canonical SMILES for [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite is CN(OS(=O)O)c1ccc2cc(C(=O)Nc3cccc(-c4cnccc4C(F)(F)F)c3)[nH]c2c1.
What is the InChIKey of [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite?
The InChIKey is RIPICGZRFKGILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F3N4O4S/c1-29(33-34(31)32)16-6-5-14-10-20(28-19(14)11-16)21(30)27-15-4-2-3-13(9-15)17-12-26-8-7-18(17)22(23,24)25/h2-12,28H,1H3,(H,27,30)(H,31,32).
What are the key properties of [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite?
[methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite has a molecular weight of 490.46 g/mol, XLogP of 5.01, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl-[2-[[3-[4-(trifluoromethyl)-3-pyridinyl]phenyl]carbamoyl]-1H-indol-6-yl]amino] hydrogen sulfite is sourced from PubChem (CID 174905768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).