About (2-methyl-1,3-thiazolidin-3-yl)methanol
(2-methyl-1,3-thiazolidin-3-yl)methanol (PubChem CID 174906365) has the molecular formula C5H11NOS
and a molecular weight of 133.22 g/mol. Its IUPAC name is (2-methyl-1,3-thiazolidin-3-yl)methanol.
Molecular Properties
| Compound Name | (2-methyl-1,3-thiazolidin-3-yl)methanol |
| PubChem CID | 174906365 |
| Molecular Formula | C5H11NOS |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | (2-methyl-1,3-thiazolidin-3-yl)methanol |
| SMILES | CC1SCCN1CO |
| InChI | InChI=1S/C5H11NOS/c1-5-6(4-7)2-3-8-5/h5,7H,2-4H2,1H3 |
| InChIKey | IJOUBQRGWIPMNT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-1,3-thiazolidin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-thiazolidin-3-yl)methanol?
The IUPAC name of (2-methyl-1,3-thiazolidin-3-yl)methanol (CID 174906365) is (2-methyl-1,3-thiazolidin-3-yl)methanol.
What is the SMILES notation for (2-methyl-1,3-thiazolidin-3-yl)methanol?
The canonical SMILES for (2-methyl-1,3-thiazolidin-3-yl)methanol is CC1SCCN1CO.
What is the InChIKey of (2-methyl-1,3-thiazolidin-3-yl)methanol?
The InChIKey is IJOUBQRGWIPMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NOS/c1-5-6(4-7)2-3-8-5/h5,7H,2-4H2,1H3.
What are the key properties of (2-methyl-1,3-thiazolidin-3-yl)methanol?
(2-methyl-1,3-thiazolidin-3-yl)methanol has a molecular weight of 133.22 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-thiazolidin-3-yl)methanol is sourced from PubChem (CID 174906365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).